cas: 27652-89-7 — see every product listed under this CAS number, including other names
4-Chlorophenyl-2-pyridinylmethanol, 99.98% (CAS 27652-89-7) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-32237-10 g |
| cas | 27652-89-7 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 2135.50 Pln | |
| MedChemExpress | 1 g | 649.42 Pln | |
| MedChemExpress | 5 g | 1462.12 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
(4-chlorophenyl)-pyridin-2-ylmethanol (CAS 27652-89-7) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: (4-chlorophenyl)-pyridin-2-ylmethanol. InChIKey: ZFUPOFQRQNJDNS-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (4-chlorophenyl)-pyridin-2-ylmethanol |
| InChIKey | ZFUPOFQRQNJDNS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)