CAS 34328-31-9 appears in our catalog under these names: (4-Chlorophenyl)(4-(trifluoromethyl)phenyl)methanone, 95%, (4-Chlorophenyl)(4-(trifluoromethyl)phenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 0,25g, 1g, 2g.
(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanone (CAS 34328-31-9) is a chemical compound with the molecular formula C14H8ClF3O and a molecular weight of 284.66 g/mol. IUPAC name: (4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanone. InChIKey: RHOAOVIKZMOITD-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3O |
|---|---|
| Molecular weight | 284.66 g/mol |
| IUPAC name | (4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methanone |
| InChIKey | RHOAOVIKZMOITD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)