CAS 789-96-8 is the registry number for 2-Chloro-5-(trifluoromethyl)benzophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
[2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanone (CAS 789-96-8) is a chemical compound with the molecular formula C14H8ClF3O and a molecular weight of 284.66 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanone. InChIKey: QHDJJBSLUFDASY-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3O |
|---|---|
| Molecular weight | 284.66 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)phenyl]-phenylmethanone |
| InChIKey | QHDJJBSLUFDASY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)