Products 180340-74-3

CAS 180340-74-3 appears in our catalog under these names: 4'-(Trifluoromethyl)-(1,1'-biphenyl)-2-carbonyl chloride, 95-<97%, 4'-(Trifluoromethyl)-(1,1'-biphenyl)-2-carbonyl chloride, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-[4-(trifluoromethyl)phenyl]benzoyl chloride (CAS 180340-74-3) is a chemical compound with the molecular formula C14H8ClF3O and a molecular weight of 284.66 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]benzoyl chloride. InChIKey: VFDVBQMLLPCXNP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8ClF3O
Molecular weight284.66 g/mol
IUPAC name2-[4-(trifluoromethyl)phenyl]benzoyl chloride
InChIKeyVFDVBQMLLPCXNP-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(C=C2)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)