CAS 180340-74-3 appears in our catalog under these names: 4'-(Trifluoromethyl)-(1,1'-biphenyl)-2-carbonyl chloride, 95-<97%, 4'-(Trifluoromethyl)-(1,1'-biphenyl)-2-carbonyl chloride, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-[4-(trifluoromethyl)phenyl]benzoyl chloride (CAS 180340-74-3) is a chemical compound with the molecular formula C14H8ClF3O and a molecular weight of 284.66 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]benzoyl chloride. InChIKey: VFDVBQMLLPCXNP-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3O |
|---|---|
| Molecular weight | 284.66 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]benzoyl chloride |
| InChIKey | VFDVBQMLLPCXNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)