cas: 911210-53-2 — see every product listed under this CAS number, including other names
(4-Cyano-3,5-dimethylphenyl)boronic acid (CAS 911210-53-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620964-1G |
| cas | 911210-53-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5443.93 Pln |
| delivery time | 3-4 weeks |
|---|
(4-cyano-3,5-dimethylphenyl)boronic acid (CAS 911210-53-2) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (4-cyano-3,5-dimethylphenyl)boronic acid. InChIKey: SMOJCKXRQXGIOL-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (4-cyano-3,5-dimethylphenyl)boronic acid |
| InChIKey | SMOJCKXRQXGIOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C#N)C)(O)O |
Computed by PubChem (NCBI)