Products 911210-53-2
CAS 911210-53-2 appears in our catalog under these names: 4-Cyano-3,5-dimethylphenylboronic acid, 95%, (4-Cyano-3,5-dimethylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
(4-cyano-3,5-dimethylphenyl)boronic acid (CAS 911210-53-2) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (4-cyano-3,5-dimethylphenyl)boronic acid. InChIKey: SMOJCKXRQXGIOL-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (4-cyano-3,5-dimethylphenyl)boronic acid |
| InChIKey | SMOJCKXRQXGIOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C#N)C)(O)O |
Computed by PubChem (NCBI)