cas: 911210-53-2 — see every product listed under this CAS number, including other names
(4-Cyano-3,5-dimethylphenyl)boronic acid, 98% (CAS 911210-53-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1444590-10g |
| cas | 911210-53-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 23427.88 Pln | |
| AmBeed | 5g | 13780.06 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-cyano-3,5-dimethylphenyl)boronic acid (CAS 911210-53-2) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (4-cyano-3,5-dimethylphenyl)boronic acid. InChIKey: SMOJCKXRQXGIOL-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (4-cyano-3,5-dimethylphenyl)boronic acid |
| InChIKey | SMOJCKXRQXGIOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C#N)C)(O)O |
Computed by PubChem (NCBI)