cas: 2377606-69-2 — see every product listed under this CAS number, including other names
(4-Fluoro-5-formyl-2-methylphenyl)boronic acid 97% (CAS 2377606-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A445881-100mg |
| cas | 2377606-69-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 303.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A445881 |
(4-fluoro-5-formyl-2-methylphenyl)boronic acid (CAS 2377606-69-2) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (4-fluoro-5-formyl-2-methylphenyl)boronic acid. InChIKey: BGWYJGKMSSYAEL-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (4-fluoro-5-formyl-2-methylphenyl)boronic acid |
| InChIKey | BGWYJGKMSSYAEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)C=O)(O)O |
Computed by PubChem (NCBI)