CAS 1310384-23-6 appears in our catalog under these names: 4-Fluoro-3-formyl-5-methylphenylboronic acid, 98%, (4-Fluoro-3-formyl-5-methylphenyl)boronic acid 98%, 4-Fluoro-3-formyl-5-methylphenylboronic acid, 98%, 98%, (4-Fluoro-3-formyl-5-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
(4-fluoro-3-formyl-5-methylphenyl)boronic acid (CAS 1310384-23-6) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (4-fluoro-3-formyl-5-methylphenyl)boronic acid. InChIKey: CYTRJUULLDUDAX-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (4-fluoro-3-formyl-5-methylphenyl)boronic acid |
| InChIKey | CYTRJUULLDUDAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C=O)F)C)(O)O |
Computed by PubChem (NCBI)