CAS 870778-95-3 appears in our catalog under these names: 3–Acetyl–2–fluorophenylboronic acid, 3-Acetyl-2-fluorophenylboronic acid, 98%, (3-Acetyl-2-fluorophenyl)boronic acid, (3-Acetyl-2-fluorophenyl)boronic acid, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 100g, 25g, 1g, 5g.
(3-acetyl-2-fluorophenyl)boronic acid (CAS 870778-95-3) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (3-acetyl-2-fluorophenyl)boronic acid. InChIKey: SEMRLZGDJZRZMC-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (3-acetyl-2-fluorophenyl)boronic acid |
| InChIKey | SEMRLZGDJZRZMC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)C)F)(O)O |
Computed by PubChem (NCBI)