cas: 214907-24-1 — see every product listed under this CAS number, including other names
(4-Fluorostyryl)boronic acid 95% (CAS 214907-24-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A699875-250mg |
| cas | 214907-24-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Ambeed | 5g | 3051.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A699875 |
[(E)-2-(4-fluorophenyl)ethenyl]boronic acid (CAS 214907-24-1) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: [(E)-2-(4-fluorophenyl)ethenyl]boronic acid. InChIKey: GBNJRIQSFJFDII-AATRIKPKSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | [(E)-2-(4-fluorophenyl)ethenyl]boronic acid |
| InChIKey | GBNJRIQSFJFDII-AATRIKPKSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)F)(O)O |
Computed by PubChem (NCBI)