CAS 849062-22-2 appears in our catalog under these names: trans–2–(3–Fluorophenyl)vinylboronic acid, trans-2-(3-Fluorophenyl)vinylboronic acid, 97%, (E)-(3-Fluorostyryl)boronic acid, 98%, 98%, (E)-(3-Fluorostyryl)boronic acid, 98%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
[(E)-2-(3-fluorophenyl)ethenyl]boronic acid (CAS 849062-22-2) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: [(E)-2-(3-fluorophenyl)ethenyl]boronic acid. InChIKey: ONXKUGHKGCSZJO-SNAWJCMRSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | [(E)-2-(3-fluorophenyl)ethenyl]boronic acid |
| InChIKey | ONXKUGHKGCSZJO-SNAWJCMRSA-N |
| SMILES | B(/C=C/C1=CC(=CC=C1)F)(O)O |
Computed by PubChem (NCBI)