CAS 214907-24-1 appears in our catalog under these names: Trans-2-(4-fluorophenyl)vinylboronic acid, 98%, TRANS-2-(4-FLUOROPHENYL)VINYLBORONIC AC&, (4-Fluorostyryl)boronic acid, 97%, 97%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
[(E)-2-(4-fluorophenyl)ethenyl]boronic acid (CAS 214907-24-1) is a chemical compound with the molecular formula C8H8BFO2 and a molecular weight of 165.96 g/mol. IUPAC name: [(E)-2-(4-fluorophenyl)ethenyl]boronic acid. InChIKey: GBNJRIQSFJFDII-AATRIKPKSA-N.
| Molecular formula | C8H8BFO2 |
|---|---|
| Molecular weight | 165.96 g/mol |
| IUPAC name | [(E)-2-(4-fluorophenyl)ethenyl]boronic acid |
| InChIKey | GBNJRIQSFJFDII-AATRIKPKSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)F)(O)O |
Computed by PubChem (NCBI)