cas: 256383-44-5 — see every product listed under this CAS number, including other names
(4-Heptylphenyl)boronic acid (CAS 256383-44-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216240-1G |
| cas | 256383-44-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1169.40 Pln | |
| Fluorochem | 5g | 4032.97 Pln |
| delivery time | 3-4 weeks |
|---|
(4-heptylphenyl)boronic acid (CAS 256383-44-5) is a chemical compound with the molecular formula C13H21BO2 and a molecular weight of 220.12 g/mol. IUPAC name: (4-heptylphenyl)boronic acid. InChIKey: RFBUNLZEBLXJKX-UHFFFAOYSA-N.
| Molecular formula | C13H21BO2 |
|---|---|
| Molecular weight | 220.12 g/mol |
| IUPAC name | (4-heptylphenyl)boronic acid |
| InChIKey | RFBUNLZEBLXJKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCCCCC)(O)O |
Computed by PubChem (NCBI)