cas: 256383-44-5 — see every product listed under this CAS number, including other names
4-N-HEPTYLPHENYLBORONIC ACID, 98%, 98% (CAS 256383-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBMD-100mg |
| cas | 256383-44-5 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-heptylphenyl)boronic acid (CAS 256383-44-5) is a chemical compound with the molecular formula C13H21BO2 and a molecular weight of 220.12 g/mol. IUPAC name: (4-heptylphenyl)boronic acid. InChIKey: RFBUNLZEBLXJKX-UHFFFAOYSA-N.
| Molecular formula | C13H21BO2 |
|---|---|
| Molecular weight | 220.12 g/mol |
| IUPAC name | (4-heptylphenyl)boronic acid |
| InChIKey | RFBUNLZEBLXJKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCCCCC)(O)O |
Computed by PubChem (NCBI)