cas: 5267-46-9 — see every product listed under this CAS number, including other names
(4-METHOXYPHENYL)(PHENYL)METHANAMINE HYDROCHLORIDE, 97% (CAS 5267-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F797319-100MG |
| cas | 5267-46-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1080.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-methoxyphenyl)-phenylmethanamine;hydrochloride (CAS 5267-46-9) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (4-methoxyphenyl)-phenylmethanamine;hydrochloride. InChIKey: NCSHDWNETPLWIU-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (4-methoxyphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | NCSHDWNETPLWIU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)