CAS 50685-29-5 is the registry number for 3-[(3-Chlorophenyl)amino]-5,5-dimethylcyclohex-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-chloroanilino)-5,5-dimethylcyclohex-2-en-1-one (CAS 50685-29-5) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 3-(3-chloroanilino)-5,5-dimethylcyclohex-2-en-1-one. InChIKey: CEQJQTUWWPLELV-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 3-(3-chloroanilino)-5,5-dimethylcyclohex-2-en-1-one |
| InChIKey | CEQJQTUWWPLELV-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)