Products 106272-17-7
CAS 106272-17-7 appears in our catalog under these names: 2-(4-Phenoxyphenyl)ethanamine hydrochloride, 95%, 2-(4-Phenoxyphenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
2-(4-phenoxyphenyl)ethanamine;hydrochloride (CAS 106272-17-7) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 2-(4-phenoxyphenyl)ethanamine;hydrochloride. InChIKey: DDPZOCJKUCGMIQ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 2-(4-phenoxyphenyl)ethanamine;hydrochloride |
| InChIKey | DDPZOCJKUCGMIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CCN.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-phenoxyphenyl)ethanamine Hydrochloride, Benzeneethanamine, 4-phenoxy-, hydrochloride, 2-(4-phenoxyphenyl)ethanamine;hydrochloride, 4-Phenoxy-benzeneethanamine HCl, 4-Phenoxy-benzeneethanamine hydrochloride, 2-(4-phenoxyphenyl)ethanamineHydrochloride, 2-(4-Phenoxyphenyl)ethan-1-amine--hydrogen chloride (1/1)