cas: 860034-09-9 — see every product listed under this CAS number, including other names
(4-Methoxy-2-nitrophenyl)boronic acid 98% (CAS 860034-09-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A787749-10g |
| cas | 860034-09-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1443.94 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 25g | 2984.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A787749 |
(4-methoxy-2-nitrophenyl)boronic acid (CAS 860034-09-9) is a chemical compound with the molecular formula C7H8BNO5 and a molecular weight of 196.96 g/mol. IUPAC name: (4-methoxy-2-nitrophenyl)boronic acid. InChIKey: PFTLRSTZYYFBNF-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO5 |
|---|---|
| Molecular weight | 196.96 g/mol |
| IUPAC name | (4-methoxy-2-nitrophenyl)boronic acid |
| InChIKey | PFTLRSTZYYFBNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)