cas: 860034-09-9 — see every product listed under this CAS number, including other names
(4-Methoxy-2-nitrophenyl)boronic acid, 95% (CAS 860034-09-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337948-250MG |
| cas | 860034-09-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 500mg | 253.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-methoxy-2-nitrophenyl)boronic acid (CAS 860034-09-9) is a chemical compound with the molecular formula C7H8BNO5 and a molecular weight of 196.96 g/mol. IUPAC name: (4-methoxy-2-nitrophenyl)boronic acid. InChIKey: PFTLRSTZYYFBNF-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO5 |
|---|---|
| Molecular weight | 196.96 g/mol |
| IUPAC name | (4-methoxy-2-nitrophenyl)boronic acid |
| InChIKey | PFTLRSTZYYFBNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)