CAS 3462-97-3 appears in our catalog under these names: (4-Methoxybenzyl)triphenylphosphonium chloride, 97% , (4-Methoxybenzyl)triphenylphosphonium chloride, 95%, 4-Methoxybenzyl triphenylphosphonium chloride, (4-Methoxybenzyl)triphenylphosphonium chloride, 95%, 95%, (4-Methoxybenzyl)triphenylphosphonium chloride, 98%. Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 50g, 1g, 25g, 5g, 250g, 100g.
(4-methoxyphenyl)methyl-triphenylphosphanium chloride (CAS 3462-97-3) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: (4-methoxyphenyl)methyl-triphenylphosphanium chloride. InChIKey: YQXBNCFNXOFWLR-UHFFFAOYSA-M.
| Molecular formula | C26H24ClOP |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | YQXBNCFNXOFWLR-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)