cas: 1106986-47-3 — see every product listed under this CAS number, including other names
(4-Morpholinophenyl)methanamine hydrochloride 97% (CAS 1106986-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A748566-100mg |
| cas | 1106986-47-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1905.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A748566 |
(4-morpholin-4-ylphenyl)methanamine;hydrochloride (CAS 1106986-47-3) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: (4-morpholin-4-ylphenyl)methanamine;hydrochloride. InChIKey: OBPSVZJTAZJLLT-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | (4-morpholin-4-ylphenyl)methanamine;hydrochloride |
| InChIKey | OBPSVZJTAZJLLT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)