Products 1171028-56-0

CAS 1171028-56-0 appears in our catalog under these names: 2,6-Dimethyl-4-(pyridin-4-yl)morpholine hydrochloride, 95%, 2,6-Dimethyl-4-(pyridin-4-yl)morpholine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride (CAS 1171028-56-0) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride. InChIKey: XVWNTLZQVWXJOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2O
Molecular weight228.72 g/mol
IUPAC name2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride
InChIKeyXVWNTLZQVWXJOE-UHFFFAOYSA-N
SMILESCC1CN(CC(O1)C)C2=CC=NC=C2.Cl

Computed by PubChem (NCBI)