Products 55880-87-0
CAS 55880-87-0 is the registry number for N-(1-Methyl-2-phenylethyl)glycinamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-oxo-2-(1-phenylpropan-2-ylamino)ethyl]azanium chloride (CAS 55880-87-0) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: [2-oxo-2-(1-phenylpropan-2-ylamino)ethyl]azanium chloride. InChIKey: FPEZDJRFEAWPCG-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | [2-oxo-2-(1-phenylpropan-2-ylamino)ethyl]azanium chloride |
| InChIKey | FPEZDJRFEAWPCG-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)NC(=O)C[NH3+].[Cl-] |
Computed by PubChem (NCBI)