(4-Phenylthiazol-2-yl)methanamine, 95%
cas: 90916-45-3 — see every product listed under this CAS number, including other names
(4-Phenylthiazol-2-yl)methanamine, 95% (CAS 90916-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A866167-100mg |
| cas | 90916-45-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2189.31 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 880.40 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 697.56 Pln | |
| BLDpharm | 5g | 2352.53 Pln | |
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1637.98 Pln | |
| Fluorochem | 2.5g | 3746.62 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4-phenyl-1,3-thiazol-2-yl)methanamine (CAS 90916-45-3) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanamine. InChIKey: AFSCUDNEJWEMEA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanamine |
| InChIKey | AFSCUDNEJWEMEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CN |
Computed by PubChem (NCBI)