CAS 25021-49-2 appears in our catalog under these names: 4-(2-Methylthiazol-4-yl)aniline 95%, 4-(2-Methylthiazol-4-yl)aniline, 97%, 97%, 4-(2-Methyl-1,3-thiazol-4-yl)aniline, 98%, 4-(2-Methyl-1,3-thiazol-4-yl)aniline, 95%. Offered by: Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 2.5g, 25g.
4-(2-methyl-1,3-thiazol-4-yl)aniline (CAS 25021-49-2) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)aniline. InChIKey: JCRKEVDAEUPNAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)aniline |
| InChIKey | JCRKEVDAEUPNAA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)