CAS 1249834-47-6 appears in our catalog under these names: 4-Methyl-2-phenyl-1,3-thiazol-5-amine, 95%, 4–Methyl–2–phenyl–1,3–thiazol–5–amine, 4-Methyl-2-phenyl-1,3-thiazol-5-amine, 4-Methyl-2-phenyl-1,3-thiazol-5-amine 95%, 4-Methyl-2-phenyl-1,3-thiazol-5-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 50mg, 2,5g, 5g.
4-methyl-2-phenyl-1,3-thiazol-5-amine (CAS 1249834-47-6) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-thiazol-5-amine. InChIKey: LYUISGYCYRYZPX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-thiazol-5-amine |
| InChIKey | LYUISGYCYRYZPX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)