cas: 77228-67-2 — see every product listed under this CAS number, including other names
(4-bromo-2-chlorophenoxy)acetic acid, 98% (CAS 77228-67-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F307493-250MG |
| cas | 77228-67-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 500mg | 466.52 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 2.5g | 1132.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromo-2-chlorophenoxy)acetic acid (CAS 77228-67-2) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenoxy)acetic acid. InChIKey: VCDBRFZHSIYFRO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenoxy)acetic acid |
| InChIKey | VCDBRFZHSIYFRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)OCC(=O)O |
Computed by PubChem (NCBI)