CAS 2387230-07-9 appears in our catalog under these names: 3-Bromo-2-chloro-4-hydroxy-benzoic acid methyl ester, 95%, Methyl 3-bromo-2-chloro-4-hydroxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 3-bromo-2-chloro-4-hydroxybenzoate (CAS 2387230-07-9) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: methyl 3-bromo-2-chloro-4-hydroxybenzoate. InChIKey: GOBSXKRBNKQULB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | methyl 3-bromo-2-chloro-4-hydroxybenzoate |
| InChIKey | GOBSXKRBNKQULB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)O)Br)Cl |
Computed by PubChem (NCBI)