CAS 95383-17-8 appears in our catalog under these names: 5-Bromo-4-chloro-2-methoxybenzoic acid, 98%, 5-bromo-4-chloro-2-methoxybenzoic acid, 5-Bromo-4-chloro-2-methoxybenzoic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
5-bromo-4-chloro-2-methoxybenzoic acid (CAS 95383-17-8) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: 5-bromo-4-chloro-2-methoxybenzoic acid. InChIKey: DLTGYPSSHXBNQG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-methoxybenzoic acid |
| InChIKey | DLTGYPSSHXBNQG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Br)Cl |
Computed by PubChem (NCBI)