cas: 18465-50-4 — see every product listed under this CAS number, including other names
(4AR,7R,8R,8aS)–2–methylhexahydropyrano(3,2–d)(1,3)dioxine–6,7,8–triol (CAS 18465-50-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51109-100g |
| cas | 18465-50-4 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 2469.24 Pln | |
| GLPBio | 10g | 938.72 Pln | |
| GLPBio | 1g | 559.60 Pln | |
| GLPBio | 25g | 1275.71 Pln | |
| GLPBio | 5g | 798.30 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(4aR,7R,8R,8aS)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol (CAS 18465-50-4) is a chemical compound with the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. IUPAC name: (4aR,7R,8R,8aS)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol. InChIKey: VZPBLPQAMPVTFO-DBVAJOADSA-N.
| Molecular formula | C8H14O6 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (4aR,7R,8R,8aS)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
| InChIKey | VZPBLPQAMPVTFO-DBVAJOADSA-N |
| SMILES | CC1OC[C@@H]2[C@@H](O1)[C@@H]([C@H](C(O2)O)O)O |
Computed by PubChem (NCBI)