CAS 105453-33-6 appears in our catalog under these names: Etoposide Impurity 8, 4,6-O-(1R)-Ethylidene-D-glucose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(2R,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanal (CAS 105453-33-6) is a chemical compound with the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanal. InChIKey: CYJNDOQNVXFIJC-OZRXBMAMSA-N.
| Molecular formula | C8H14O6 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanal |
| InChIKey | CYJNDOQNVXFIJC-OZRXBMAMSA-N |
| SMILES | C[C@@H]1OC[C@H]([C@@H](O1)[C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)