Products 13811-71-7
CAS 13811-71-7 appears in our catalog under these names: Diethyl D-(-)-Tartrate, Diethyl D–(–)–Tartrate, (-)-Diethyl D-tartrate, 99% , Diethyl D-(-)-Tartrate, >97.0%(GC), (-)-Diethyl D-tartrate, 99%, made from unnatural tartaric acid. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 5g, 100g, 250g, 500g, 25g, 25ML, 100ML, 500ML.
Diethyl (2S,3S)-2,3-dihydroxybutanedioate (CAS 13811-71-7) is a chemical compound with the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. IUPAC name: diethyl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: YSAVZVORKRDODB-WDSKDSINSA-N.
| Molecular formula | C8H14O6 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | diethyl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | YSAVZVORKRDODB-WDSKDSINSA-N |
| SMILES | CCOC(=O)[C@H]([C@@H](C(=O)OCC)O)O |
Computed by PubChem (NCBI)