cas: 65884-40-4 — see every product listed under this CAS number, including other names
(4R)-2-(4-Methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid, 97%, 97% (CAS 65884-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAAA-100mg |
| cas | 65884-40-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 827.60 Pln | |
| Chemat | 5g | 2358.80 Pln | |
| Chemat | 10g | 4125.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 65884-40-4) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: ZQRSXNJVEHLFCE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | ZQRSXNJVEHLFCE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2NC(CS2)C(=O)O |
Computed by PubChem (NCBI)