Products 436087-50-2

CAS 436087-50-2 is the registry number for ((2-[(3-Methylphenyl)amino]-2-oxoethyl)thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetic acid (CAS 436087-50-2) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetic acid. InChIKey: LNAMMVKVASNLLF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO3S
Molecular weight239.29 g/mol
IUPAC name2-[2-(3-methylanilino)-2-oxoethyl]sulfanylacetic acid
InChIKeyLNAMMVKVASNLLF-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)NC(=O)CSCC(=O)O

Computed by PubChem (NCBI)