CAS 73696-28-3 is the registry number for 1-Tosylpyrrolidin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
1-(4-methylphenyl)sulfonylpyrrolidin-3-one (CAS 73696-28-3) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrolidin-3-one. InChIKey: BMJNDUPYCKAYAG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrolidin-3-one |
| InChIKey | BMJNDUPYCKAYAG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=O)C2 |
Computed by PubChem (NCBI)