cas: 145589-03-3 — see every product listed under this CAS number, including other names
(4R)-3-(3-Methyl-1-oxobutyl)-4-(phenylmethyl)-2-oxazolidinone, 97%, 97% (CAS 145589-03-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112D8H-1g |
| cas | 145589-03-3 |
| size | 1g |
| availability | 80g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 256.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4R)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one (CAS 145589-03-3) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (4R)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one. InChIKey: JHGXEUXQJIKZMY-CYBMUJFWSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (4R)-4-benzyl-3-(3-methylbutanoyl)-1,3-oxazolidin-2-one |
| InChIKey | JHGXEUXQJIKZMY-CYBMUJFWSA-N |
| SMILES | CC(C)CC(=O)N1[C@@H](COC1=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)