CAS 1387445-50-2 appears in our catalog under these names: 5-Methoxy-7-methylindole-1-carboxylic acid tert-butyl ester, 95%, tert–Butyl 5–methoxy–7–methyl–1H–indole–1–carboxylate, tert-Butyl 5-methoxy-7-methyl-1H-indole-1-carboxylate 97%, 1H-Indole-1-carboxylic acid, 5-methoxy-7-methyl-, 1,1-dimethylethyl ester, 98%, 98%, tert-Butyl 5-methoxy-7-methyl-1H-indole-1-carboxylate, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g.
Tert-butyl 5-methoxy-7-methylindole-1-carboxylate (CAS 1387445-50-2) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: tert-butyl 5-methoxy-7-methylindole-1-carboxylate. InChIKey: OMZYGXJHKONVSJ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | tert-butyl 5-methoxy-7-methylindole-1-carboxylate |
| InChIKey | OMZYGXJHKONVSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(C=C2)C(=O)OC(C)(C)C)OC |
Computed by PubChem (NCBI)