CAS 926255-10-9 appears in our catalog under these names: 1-[(3,5-Dimethylphenyl)carbonyl]piperidine-3-carboxylic acid, 95%, 1-(3,5-Dimethylbenzoyl)piperidine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
1-(3,5-dimethylbenzoyl)piperidine-3-carboxylic acid (CAS 926255-10-9) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: 1-(3,5-dimethylbenzoyl)piperidine-3-carboxylic acid. InChIKey: FJLNQZUVLMNZHZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | 1-(3,5-dimethylbenzoyl)piperidine-3-carboxylic acid |
| InChIKey | FJLNQZUVLMNZHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N2CCCC(C2)C(=O)O)C |
Computed by PubChem (NCBI)