cas: 143654-01-7 — see every product listed under this CAS number, including other names
(4S,5R)-4-Methyl-5-phenyl-3-propionyl-2-oxazolidinone, >97%, >97% (CAS 143654-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BX6-100mg |
| cas | 143654-01-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 702.80 Pln | |
| Chemat | 5g | 2282.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
(4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 143654-01-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: ZMRFZBKROHCLIL-CABZTGNLSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | ZMRFZBKROHCLIL-CABZTGNLSA-N |
| SMILES | CCC(=O)N1[C@H]([C@H](OC1=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)