cas: 143654-01-7 — see every product listed under this CAS number, including other names
(4S,5R)-4-Methyl-5-phenyl-3-propionyloxazolidin-2-one (CAS 143654-01-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447154-250MG |
| cas | 143654-01-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 5g | 3751.82 Pln |
| delivery time | 3-4 weeks |
|---|
(4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 143654-01-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: ZMRFZBKROHCLIL-CABZTGNLSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4S,5R)-4-methyl-5-phenyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | ZMRFZBKROHCLIL-CABZTGNLSA-N |
| SMILES | CCC(=O)N1[C@H]([C@H](OC1=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)