cas: 37031-30-4 — see every product listed under this CAS number, including other names
(4S,5S)-Dimethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate 95% (CAS 37031-30-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A837721-250mg |
| cas | 37031-30-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 10g | 453.81 Pln | |
| Ambeed | 25g | 954.44 Pln | |
| Ambeed | 100g | 3541.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A837721 |
Dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate (CAS 37031-30-4) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate. InChIKey: ROZOUYVVWUTPNG-WDSKDSINSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| InChIKey | ROZOUYVVWUTPNG-WDSKDSINSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)C(=O)OC)C(=O)OC)C |
Computed by PubChem (NCBI)