CAS 20789-62-2 is the registry number for (5S,8R,9R)-8,9-Dihydroxy-2,2-dimethyl-1,3,6-trioxaspiro[4.5]decan-10-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S,7R,8R)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one (CAS 20789-62-2) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (5S,7R,8R)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one. InChIKey: RDTDFLCQMKPKBO-KCRUCZTKSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (5S,7R,8R)-7,8-dihydroxy-2,2-dimethyl-1,3,10-trioxaspiro[4.5]decan-6-one |
| InChIKey | RDTDFLCQMKPKBO-KCRUCZTKSA-N |
| SMILES | CC1(OC[C@]2(O1)C(=O)[C@@H]([C@@H](CO2)O)O)C |
Computed by PubChem (NCBI)