Products 94697-68-4
CAS 94697-68-4 appears in our catalog under these names: 5,6-O-Isopropylidene-l-gulono-1,4-lactone, 95%, 5,6-O-Isopropylidene-L-gulono-1,4-lactone, 5,6-O-Isopropylidene-L-gulonic acid-1,4-lactone, 5,6-Isopropylidene-L-gulonic acid γ-lactone. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 5g, 1g, 2g, 10g, 50g, 25g, 5 g, 100 mg.
(3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one (CAS 94697-68-4) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one. InChIKey: JNTPPVKRHGNFKM-BNHYGAARSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3S,4R,5S)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one |
| InChIKey | JNTPPVKRHGNFKM-BNHYGAARSA-N |
| SMILES | CC1(OC[C@H](O1)[C@@H]2[C@@H]([C@@H](C(=O)O2)O)O)C |
Computed by PubChem (NCBI)