cas: 1383428-22-5 — see every product listed under this CAS number, including other names
(4aR,7aR)-tert-Butyl hexahydropyrrolo[3,4-b][1,4]oxazine-6(2H)-carboxylate, 98% (CAS 1383428-22-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603004-50MG |
| cas | 1383428-22-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 690.40 Pln | |
| Fluorochem | 100mg | 909.07 Pln | |
| Fluorochem | 250mg | 1606.74 Pln | |
| Fluorochem | 500mg | 2486.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate (CAS 1383428-22-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: AUXXIKSVHUSTOA-RKDXNWHRSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | AUXXIKSVHUSTOA-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@@H](C1)OCCN2 |
Computed by PubChem (NCBI)