cas: 1383428-22-5 — see every product listed under this CAS number, including other names
tert-butyl (4aR,7aR)-octahydropyrrolo[3,4-b]morpholine-6-carboxylate, 97%, 97% (CAS 1383428-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUDU-100mg |
| cas | 1383428-22-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 1466.00 Pln | |
| Chemat | 1g | 3568.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate (CAS 1383428-22-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: AUXXIKSVHUSTOA-RKDXNWHRSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aR,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | AUXXIKSVHUSTOA-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@@H](C1)OCCN2 |
Computed by PubChem (NCBI)