Products 785825-41-4
CAS 785825-41-4 appears in our catalog under these names: Boc-D-Pro-NHMe, 97%, (R)-tert-Butyl 2-(methylcarbamoyl)pyrrolidine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
Tert-butyl (2R)-2-(methylcarbamoyl)pyrrolidine-1-carboxylate (CAS 785825-41-4) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (2R)-2-(methylcarbamoyl)pyrrolidine-1-carboxylate. InChIKey: JTLUSFVWHVIZGT-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-(methylcarbamoyl)pyrrolidine-1-carboxylate |
| InChIKey | JTLUSFVWHVIZGT-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)NC |
Computed by PubChem (NCBI)