cas: 159991-07-8 — see every product listed under this CAS number, including other names
(4aS,7aS)-tert-Butyl octahydro-1H-pyrrolo(3,4-b)pyridine-1-carboxylate, 95% (CAS 159991-07-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A455695-5g |
| cas | 159991-07-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11879.14 Pln | |
| AmBeed | 1g | 4718.14 Pln | |
| AmBeed | 10g | 22210.51 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate (CAS 159991-07-8) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate. InChIKey: LGEWGFOMLJQHLL-VHSXEESVSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate |
| InChIKey | LGEWGFOMLJQHLL-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2[C@H]1CNC2 |
Computed by PubChem (NCBI)