CAS 1373923-06-8 is the registry number for (3as,7as)-rel-tert-butyl octahydro-1h-pyrrolo[3,2-b]pyridine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
Tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-1-carboxylate (CAS 1373923-06-8) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-1-carboxylate. InChIKey: XEDSJRNOTLOESP-NXEZZACHSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-1-carboxylate |
| InChIKey | XEDSJRNOTLOESP-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1CCCN2 |
Computed by PubChem (NCBI)