CAS 886766-34-3 appears in our catalog under these names: tert-Butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate, 95%, 5,8-diaza-spiro(3.5)nonane-5-carboxylic acid tert-butyl ester, tert-Butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate 97%, tert-Butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate, 97%, 97%, 5,8-DIAZA-SPIRO[3.5]NONANE-5-CARBOXYLIC ACID TERT-BUTYL ESTER, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g.
Tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate (CAS 886766-34-3) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate. InChIKey: YZZOBJMUDHAXFE-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 5,8-diazaspiro[3.5]nonane-5-carboxylate |
| InChIKey | YZZOBJMUDHAXFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC12CCC2 |
Computed by PubChem (NCBI)